C18H17FN4O4S — CID 135884718
N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,4-dimethoxybenzenesulfonamide (PubChem CID 135884718) has the molecular formula C18H17FN4O4S and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135884718 |
| Molecular Formula | C18H17FN4O4S |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-[(E)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N/N=C/c2cn[nH]c2-c2ccc(F)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H17FN4O4S/c1-26-15-7-8-17(16(9-15)27-2)28(24,25)23-21-11-13-10-20-22-18(13)12-3-5-14(19)6-4-12/h3-11,23H,1-2H3,(H,20,22)/b21-11+ |
| InChIKey | FJHVAMKBWGNEAP-SRZZPIQSSA-N |
| XLogP | 2.55 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|