C18H17ClN4O2S — CID 135624522
N-[(Z)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,5-dimethylbenzenesulfonamide (PubChem CID 135624522) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 135624522 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N/N=C\c2cn[nH]c2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H17ClN4O2S/c1-12-3-4-13(2)17(9-12)26(24,25)23-21-11-15-10-20-22-18(15)14-5-7-16(19)8-6-14/h3-11,23H,1-2H3,(H,20,22)/b21-11- |
| InChIKey | HSLGGOYDPOCRHY-NHDPSOOVSA-N |
| XLogP | 3.66 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|