C18H16Cl2N4O2S — CID 135647557
2,5-dichloro-N-[(Z)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 135647557) has the molecular formula C18H16Cl2N4O2S and a molecular weight of 423.33 g/mol. Its IUPAC name is 2,5-dichloro-N-[(Z)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[(Z)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135647557 |
| Molecular Formula | C18H16Cl2N4O2S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2,5-dichloro-N-[(Z)-[5-(4-ethylphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | CCc1ccc(-c2[nH]ncc2/C=N\NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N4O2S/c1-2-12-3-5-13(6-4-12)18-14(10-21-23-18)11-22-24-27(25,26)17-9-15(19)7-8-16(17)20/h3-11,24H,2H2,1H3,(H,21,23)/b22-11- |
| InChIKey | WYSCRHKBLDDWKG-JJFYIABZSA-N |
| XLogP | 4.26 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|