C20H21FN4O2S — CID 135958282
4-[(2S)-butan-2-yl]-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 135958282) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-[(2S)-butan-2-yl]-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135958282 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-[(2S)-butan-2-yl]-N-[(Z)-[5-(4-fluorophenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)N/N=C\c2cn[nH]c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-3-14(2)15-6-10-19(11-7-15)28(26,27)25-23-13-17-12-22-24-20(17)16-4-8-18(21)9-5-16/h4-14,25H,3H2,1-2H3,(H,22,24)/b23-13-/t14-/m0/s1 |
| InChIKey | CTXJCTBCGNUMBG-LTOJSDLTSA-N |
| XLogP | 4.04 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|