C19H20N4O5S — CID 135873349
2,5-dimethoxy-N-[(E)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide (PubChem CID 135873349) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 2,5-dimethoxy-N-[(E)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 2,5-dimethoxy-N-[(E)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135873349 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2,5-dimethoxy-N-[(E)-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]methylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(-c2[nH]ncc2/C=N/NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C19H20N4O5S/c1-26-15-6-4-13(5-7-15)19-14(11-20-22-19)12-21-23-29(24,25)18-10-16(27-2)8-9-17(18)28-3/h4-12,23H,1-3H3,(H,20,22)/b21-12+ |
| InChIKey | RADJGKMLUKVFSX-CIAFOILYSA-N |
| XLogP | 2.41 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|