C14H12Cl2N2O2S — CID 668213
N-[(2,4-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 668213) has the molecular formula C14H12Cl2N2O2S and a molecular weight of 343.24 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 668213 |
| Molecular Formula | C14H12Cl2N2O2S |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2N2O2S/c1-10-2-6-13(7-3-10)21(19,20)18-17-9-11-4-5-12(15)8-14(11)16/h2-9,18H,1H3 |
| InChIKey | ZMGPGWNJNGJJJD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|