C20H15ClF2IN3O2S — CID 164900770
N-[(E)-[4-(2-chloro-4-iodoanilino)-2,3-difluorophenyl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 164900770) has the molecular formula C20H15ClF2IN3O2S and a molecular weight of 561.78 g/mol. Its IUPAC name is N-[(E)-[4-(2-chloro-4-iodoanilino)-2,3-difluorophenyl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[4-(2-chloro-4-iodoanilino)-2,3-difluorophenyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164900770 |
| Molecular Formula | C20H15ClF2IN3O2S |
| Molecular Weight | 561.78 g/mol |
| Exact Mass | 560.96 |
| IUPAC Name | N-[(E)-[4-(2-chloro-4-iodoanilino)-2,3-difluorophenyl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C/c2ccc(Nc3ccc(I)cc3Cl)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H15ClF2IN3O2S/c1-12-2-6-15(7-3-12)30(28,29)27-25-11-13-4-8-18(20(23)19(13)22)26-17-9-5-14(24)10-16(17)21/h2-11,26-27H,1H3/b25-11+ |
| InChIKey | FRYRSIAOIKADAG-OPEKNORGSA-N |
| XLogP | 5.59 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.78 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|