C15H14Cl2N2O3S — CID 6908616
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-ethoxybenzenesulfonamide (PubChem CID 6908616) has the molecular formula C15H14Cl2N2O3S and a molecular weight of 373.26 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 6908616 |
| Molecular Formula | C15H14Cl2N2O3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2N2O3S/c1-2-22-13-5-7-14(8-6-13)23(20,21)19-18-10-11-3-4-12(16)9-15(11)17/h3-10,19H,2H2,1H3/b18-10+ |
| InChIKey | JWMOHVOLSJSCOX-VCHYOVAHSA-N |
| XLogP | 3.70 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|