C17H20N2O5S — CID 110516755
N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-ethoxybenzenesulfonamide (PubChem CID 110516755) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110516755 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C/c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-4-24-14-5-8-16(9-6-14)25(20,21)19-18-12-13-11-15(22-2)7-10-17(13)23-3/h5-12,19H,4H2,1-3H3/b18-12+ |
| InChIKey | CTUBOSUNRHLFOX-LDADJPATSA-N |
| XLogP | 2.41 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|