C8H8Cl2N2O2S — CID 867204
N-[(2,4-dichlorophenyl)methylideneamino]methanesulfonamide (PubChem CID 867204) has the molecular formula C8H8Cl2N2O2S and a molecular weight of 267.14 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]methanesulfonamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]methanesulfonamide |
|---|---|
| PubChem CID | 867204 |
| Molecular Formula | C8H8Cl2N2O2S |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]methanesulfonamide |
| SMILES | CS(=O)(=O)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N2O2S/c1-15(13,14)12-11-5-6-2-3-7(9)4-8(6)10/h2-5,12H,1H3 |
| InChIKey | JNBSEGUPZZJMMZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|