C10H12Cl2N4O2 — CID 20849549
acetic acid;N'-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]methanimidamide (PubChem CID 20849549) has the molecular formula C10H12Cl2N4O2 and a molecular weight of 291.14 g/mol. Its IUPAC name is acetic acid;N'-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]methanimidamide.
| Compound Name | acetic acid;N'-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]methanimidamide |
|---|---|
| PubChem CID | 20849549 |
| Molecular Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | acetic acid;N'-[(2E)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]methanimidamide |
| SMILES | CC(=O)O.N/C=N\N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N4.C2H4O2/c9-7-2-1-6(8(10)3-7)4-12-14-13-5-11;1-2(3)4/h1-5,14H,(H2,11,13);1H3,(H,3,4)/b12-4+; |
| InChIKey | TWABNBIJBFGRLC-AQCBZIOHSA-N |
| XLogP | 1.91 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|