C8H10Cl2N6 — CID 155130444
1,2-diamino-3-[(E)-(2,4-dichlorophenyl)methylideneamino]guanidine (PubChem CID 155130444) has the molecular formula C8H10Cl2N6 and a molecular weight of 261.12 g/mol. Its IUPAC name is 1,2-diamino-3-[(E)-(2,4-dichlorophenyl)methylideneamino]guanidine.
| Compound Name | 1,2-diamino-3-[(E)-(2,4-dichlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 155130444 |
| Molecular Formula | C8H10Cl2N6 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1,2-diamino-3-[(E)-(2,4-dichlorophenyl)methylideneamino]guanidine |
| SMILES | N/N=C(\NN)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H10Cl2N6/c9-6-2-1-5(7(10)3-6)4-13-16-8(14-11)15-12/h1-4H,11-12H2,(H2,14,15,16)/b13-4+ |
| InChIKey | DEDROKAOQRLGEW-YIXHJXPBSA-N |
| XLogP | 0.61 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|