C16H13N5O5 — CID 135729114
4-methoxy-N-[(E)-[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 135729114) has the molecular formula C16H13N5O5 and a molecular weight of 355.31 g/mol. Its IUPAC name is 4-methoxy-N-[(E)-[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-methoxy-N-[(E)-[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 135729114 |
| Molecular Formula | C16H13N5O5 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 4-methoxy-N-[(E)-[5-(5-nitrofuran-2-yl)-1H-pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2cn[nH]c2-c2ccc([N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C16H13N5O5/c1-25-12-4-2-10(3-5-12)16(22)20-18-9-11-8-17-19-15(11)13-6-7-14(26-13)21(23)24/h2-9H,1H3,(H,17,19)(H,20,22)/b18-9+ |
| InChIKey | MWRWLIUHTPFPNH-GIJQJNRQSA-N |
| XLogP | 2.35 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|