C18H17ClN6O3 — CID 1414618
N-[[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 1414618) has the molecular formula C18H17ClN6O3 and a molecular weight of 400.83 g/mol. Its IUPAC name is N-[[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-[[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 1414618 |
| Molecular Formula | C18H17ClN6O3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NN=C/C(Cl)=C/c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C18H17ClN6O3/c1-23-16-15(17(27)24(2)18(23)28)25(11-20-16)10-14(26)22-21-9-13(19)8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,22,26)/b13-8-,21-9? |
| InChIKey | UYQNKRFDYQWNCV-RMKNLOPESA-N |
| XLogP | 0.82 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|