C16H16ClN5O3S — CID 8879180
N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetamide (PubChem CID 8879180) has the molecular formula C16H16ClN5O3S and a molecular weight of 393.86 g/mol. Its IUPAC name is N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetamide.
| Compound Name | N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8879180 |
| Molecular Formula | C16H16ClN5O3S |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetamide |
| SMILES | Cn1nc(SCC(=O)N/N=C\C(Cl)=C\c2ccccc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H16ClN5O3S/c1-21-15(24)14(20-22(2)16(21)25)26-10-13(23)19-18-9-12(17)8-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,19,23)/b12-8-,18-9- |
| InChIKey | SWENYMNXBVSXFI-PSGQQEAGSA-N |
| XLogP | 0.95 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|