C26H22ClN5OS — CID 3313043
N-[(2-chloro-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 3313043) has the molecular formula C26H22ClN5OS and a molecular weight of 488.02 g/mol. Its IUPAC name is N-[(2-chloro-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(2-chloro-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3313043 |
| Molecular Formula | C26H22ClN5OS |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | N-[(2-chloro-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)NN=CC(Cl)=Cc3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22ClN5OS/c1-19-12-14-23(15-13-19)32-25(21-10-6-3-7-11-21)30-31-26(32)34-18-24(33)29-28-17-22(27)16-20-8-4-2-5-9-20/h2-17H,18H2,1H3,(H,29,33) |
| InChIKey | REDKXFWXKZQCFW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|