C27H24BrN5O2S — CID 4506547
N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4506547) has the molecular formula C27H24BrN5O2S and a molecular weight of 562.49 g/mol. Its IUPAC name is N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4506547 |
| Molecular Formula | C27H24BrN5O2S |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | N-[(2-bromo-3-phenylprop-2-enylidene)amino]-2-[[4-(4-methoxyphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NN=CC(Br)=Cc3ccccc3)nnc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24BrN5O2S/c1-19-8-10-21(11-9-19)26-31-32-27(33(26)23-12-14-24(35-2)15-13-23)36-18-25(34)30-29-17-22(28)16-20-6-4-3-5-7-20/h3-17H,18H2,1-2H3,(H,30,34) |
| InChIKey | RVDKWYJDBBJASJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|