C14H16N6O3S — CID 8879153
2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1-pyridin-2-ylethylideneamino]acetamide (PubChem CID 8879153) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1-pyridin-2-ylethylideneamino]acetamide.
| Compound Name | 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1-pyridin-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 8879153 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]-N-[(Z)-1-pyridin-2-ylethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CSc1nn(C)c(=O)n(C)c1=O)c1ccccn1 |
| InChI | InChI=1S/C14H16N6O3S/c1-9(10-6-4-5-7-15-10)16-17-11(21)8-24-12-13(22)19(2)14(23)20(3)18-12/h4-7H,8H2,1-3H3,(H,17,21)/b16-9- |
| InChIKey | VJEKHYWZFDGGPN-SXGWCWSVSA-N |
| XLogP | -0.49 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|