C19H22N6O2 — CID 4258546
N,N'-bis(1-pyridin-2-ylethylideneamino)pentanediamide (PubChem CID 4258546) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N,N'-bis(1-pyridin-2-ylethylideneamino)pentanediamide.
| Compound Name | N,N'-bis(1-pyridin-2-ylethylideneamino)pentanediamide |
|---|---|
| PubChem CID | 4258546 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N,N'-bis(1-pyridin-2-ylethylideneamino)pentanediamide |
| SMILES | CC(=NNC(=O)CCCC(=O)NN=C(C)c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C19H22N6O2/c1-14(16-8-3-5-12-20-16)22-24-18(26)10-7-11-19(27)25-23-15(2)17-9-4-6-13-21-17/h3-6,8-9,12-13H,7,10-11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | RVEKQAGGHNKSPP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|