C17H17Cl2N3O2 — CID 4276592
4-(2,4-dichlorophenoxy)-N-(1-pyridin-2-ylethylideneamino)butanamide (PubChem CID 4276592) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(1-pyridin-2-ylethylideneamino)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(1-pyridin-2-ylethylideneamino)butanamide |
|---|---|
| PubChem CID | 4276592 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(1-pyridin-2-ylethylideneamino)butanamide |
| SMILES | CC(=NNC(=O)CCCOc1ccc(Cl)cc1Cl)c1ccccn1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-12(15-5-2-3-9-20-15)21-22-17(23)6-4-10-24-16-8-7-13(18)11-14(16)19/h2-3,5,7-9,11H,4,6,10H2,1H3,(H,22,23) |
| InChIKey | KEVHIHXYCWJDFI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|