C18H18Cl2N2O5 — CID 135647724
4-(2,4-dichlorophenoxy)-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]butanamide (PubChem CID 135647724) has the molecular formula C18H18Cl2N2O5 and a molecular weight of 413.26 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]butanamide |
|---|---|
| PubChem CID | 135647724 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(E)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]butanamide |
| SMILES | C/C(=N\NC(=O)CCCOc1ccc(Cl)cc1Cl)c1c(O)cc(C)oc1=O |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-10-8-14(23)17(18(25)27-10)11(2)21-22-16(24)4-3-7-26-15-6-5-12(19)9-13(15)20/h5-6,8-9,23H,3-4,7H2,1-2H3,(H,22,24)/b21-11+ |
| InChIKey | LLTWZFGDJUBJCC-SRZZPIQSSA-N |
| XLogP | 3.66 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|