C9H9N3O4 — CID 5414501
2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 5414501) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5414501 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-hydroxy-N-[(Z)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | O=C(CO)N/N=C\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O4/c13-6-9(14)11-10-5-7-3-1-2-4-8(7)12(15)16/h1-5,13H,6H2,(H,11,14)/b10-5- |
| InChIKey | BMFPHSCTJXGAKD-YHYXMXQVSA-N |
| XLogP | 0.04 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|