C13H16N4O5 — CID 3511498
N-(2-methoxyethyl)-N'-[(2-nitrophenyl)methylideneamino]propanediamide (PubChem CID 3511498) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-[(2-nitrophenyl)methylideneamino]propanediamide.
| Compound Name | N-(2-methoxyethyl)-N'-[(2-nitrophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 3511498 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | N-(2-methoxyethyl)-N'-[(2-nitrophenyl)methylideneamino]propanediamide |
| SMILES | COCCNC(=O)CC(=O)NN=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O5/c1-22-7-6-14-12(18)8-13(19)16-15-9-10-4-2-3-5-11(10)17(20)21/h2-5,9H,6-8H2,1H3,(H,14,18)(H,16,19) |
| InChIKey | WKAZYRPJDFOUHS-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|