C8H8N4O3 — CID 57370038
[(2-nitrophenyl)methylideneamino](13C)urea (PubChem CID 57370038) has the molecular formula C8H8N4O3 and a molecular weight of 211.16 g/mol. Its IUPAC name is [(2-nitrophenyl)methylideneamino](13C)urea.
| Compound Name | [(2-nitrophenyl)methylideneamino](13C)urea |
|---|---|
| PubChem CID | 57370038 |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | [(2-nitrophenyl)methylideneamino](13C)urea |
| SMILES | N[13C](=O)[15NH][15N]=Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8N4O3/c9-8(13)11-10-5-6-3-1-2-4-7(6)12(14)15/h1-5H,(H3,9,11,13)/i8+1,10+1,11+1 |
| InChIKey | OEOKLBSECDAYSM-HLDOMDIUSA-N |
| XLogP | 0.60 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|