C15H17N3O3 — CID 129431796
(1R,6R)-N-[(2-nitrophenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 129431796) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (1R,6R)-N-[(2-nitrophenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6R)-N-[(2-nitrophenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 129431796 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (1R,6R)-N-[(2-nitrophenyl)methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1[N+](=O)[O-])C1[C@@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C15H17N3O3/c19-15(14-11-6-2-3-7-12(11)14)17-16-9-10-5-1-4-8-13(10)18(20)21/h1,4-5,8-9,11-12,14H,2-3,6-7H2,(H,17,19)/t11-,12-/m1/s1 |
| InChIKey | IQBZYIOEAGTXDM-VXGBXAGGSA-N |
| XLogP | 2.48 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|