C14H18N4O2S — CID 6904278
1-cyclohexyl-3-[(E)-(2-nitrophenyl)methylideneamino]thiourea (PubChem CID 6904278) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-(2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-cyclohexyl-3-[(E)-(2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6904278 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-(2-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1/C=N/NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C14H18N4O2S/c19-18(20)13-9-5-4-6-11(13)10-15-17-14(21)16-12-7-2-1-3-8-12/h4-6,9-10,12H,1-3,7-8H2,(H2,16,17,21)/b15-10+ |
| InChIKey | HLQCKRKVRWMARX-XNTDXEJSSA-N |
| XLogP | 2.73 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|