C15H20N4O2S — CID 9122061
1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea (PubChem CID 9122061) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9122061 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)N/N=C\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O2S/c1-11-6-2-4-8-13(11)17-15(22)18-16-10-12-7-3-5-9-14(12)19(20)21/h3,5,7,9-11,13H,2,4,6,8H2,1H3,(H2,17,18,22)/b16-10-/t11-,13-/m1/s1 |
| InChIKey | IGLGNIMSGHNRNQ-DORGZDKSSA-N |
| XLogP | 2.97 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|