C14H20N4O2S — CID 8668645
1-[(1S,2S)-2-methylcyclohexyl]-3-(2-nitroanilino)thiourea (PubChem CID 8668645) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-nitroanilino)thiourea.
| Compound Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-nitroanilino)thiourea |
|---|---|
| PubChem CID | 8668645 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-(2-nitroanilino)thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)NNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20N4O2S/c1-10-6-2-3-7-11(10)15-14(21)17-16-12-8-4-5-9-13(12)18(19)20/h4-5,8-11,16H,2-3,6-7H2,1H3,(H2,15,17,21)/t10-,11-/m0/s1 |
| InChIKey | QFDPSXRPWOUQJC-QWRGUYRKSA-N |
| XLogP | 2.96 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|