C13H17N5O4S — CID 8657125
1-cyclohexyl-3-(2,4-dinitroanilino)thiourea (PubChem CID 8657125) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,4-dinitroanilino)thiourea.
| Compound Name | 1-cyclohexyl-3-(2,4-dinitroanilino)thiourea |
|---|---|
| PubChem CID | 8657125 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-cyclohexyl-3-(2,4-dinitroanilino)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NNC(=S)NC2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N5O4S/c19-17(20)10-6-7-11(12(8-10)18(21)22)15-16-13(23)14-9-4-2-1-3-5-9/h6-9,15H,1-5H2,(H2,14,16,23) |
| InChIKey | NNQIMDUZVMPNDL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 122.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|