C13H19N5O4S2 — CID 3440829
1-cyclohexyl-3-(2-nitro-4-sulfamoylanilino)thiourea (PubChem CID 3440829) has the molecular formula C13H19N5O4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2-nitro-4-sulfamoylanilino)thiourea.
| Compound Name | 1-cyclohexyl-3-(2-nitro-4-sulfamoylanilino)thiourea |
|---|---|
| PubChem CID | 3440829 |
| Molecular Formula | C13H19N5O4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 1-cyclohexyl-3-(2-nitro-4-sulfamoylanilino)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NNC(=S)NC2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N5O4S2/c14-24(21,22)10-6-7-11(12(8-10)18(19)20)16-17-13(23)15-9-4-2-1-3-5-9/h6-9,16H,1-5H2,(H2,14,21,22)(H2,15,17,23) |
| InChIKey | MWQCQINGVDUXFP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|