C14H15N5O4S2 — CID 3404189
1-benzyl-3-(2-nitro-4-sulfamoylanilino)thiourea (PubChem CID 3404189) has the molecular formula C14H15N5O4S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 1-benzyl-3-(2-nitro-4-sulfamoylanilino)thiourea.
| Compound Name | 1-benzyl-3-(2-nitro-4-sulfamoylanilino)thiourea |
|---|---|
| PubChem CID | 3404189 |
| Molecular Formula | C14H15N5O4S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 1-benzyl-3-(2-nitro-4-sulfamoylanilino)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NNC(=S)NCc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O4S2/c15-25(22,23)11-6-7-12(13(8-11)19(20)21)17-18-14(24)16-9-10-4-2-1-3-5-10/h1-8,17H,9H2,(H2,15,22,23)(H2,16,18,24) |
| InChIKey | CMSRHTRGBPIKKF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|