C19H17N3O6S — CID 175280271
methyl 4-[(2-nitro-4-sulfamoylanilino)methyl]naphthalene-1-carboxylate (PubChem CID 175280271) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is methyl 4-[(2-nitro-4-sulfamoylanilino)methyl]naphthalene-1-carboxylate.
| Compound Name | methyl 4-[(2-nitro-4-sulfamoylanilino)methyl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 175280271 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | methyl 4-[(2-nitro-4-sulfamoylanilino)methyl]naphthalene-1-carboxylate |
| SMILES | COC(=O)c1ccc(CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C19H17N3O6S/c1-28-19(23)16-8-6-12(14-4-2-3-5-15(14)16)11-21-17-9-7-13(29(20,26)27)10-18(17)22(24)25/h2-10,21H,11H2,1H3,(H2,20,26,27) |
| InChIKey | GWMPEPLDQZJWJM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|