C12H14N4O4S2 — CID 133406249
4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-3-nitrobenzenesulfonamide (PubChem CID 133406249) has the molecular formula C12H14N4O4S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133406249 |
| Molecular Formula | C12H14N4O4S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 4-[(2,5-dimethyl-1,3-thiazol-4-yl)methylamino]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nc(CNc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])c(C)s1 |
| InChI | InChI=1S/C12H14N4O4S2/c1-7-11(15-8(2)21-7)6-14-10-4-3-9(22(13,19)20)5-12(10)16(17)18/h3-5,14H,6H2,1-2H3,(H2,13,19,20) |
| InChIKey | RQTDSROKYUTLLF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|