C16H20N4O4S2 — CID 121415790
4-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-(1-methylcyclopropyl)-3-nitrobenzenesulfonamide (PubChem CID 121415790) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-(1-methylcyclopropyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-(1-methylcyclopropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 121415790 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 4-[(2,4-dimethyl-1,3-thiazol-5-yl)methylamino]-N-(1-methylcyclopropyl)-3-nitrobenzenesulfonamide |
| SMILES | Cc1nc(C)c(CNc2ccc(S(=O)(=O)NC3(C)CC3)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H20N4O4S2/c1-10-15(25-11(2)18-10)9-17-13-5-4-12(8-14(13)20(21)22)26(23,24)19-16(3)6-7-16/h4-5,8,17,19H,6-7,9H2,1-3H3 |
| InChIKey | FLZXZTZRYYWFCZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|