C13H17N5O4S — CID 133279785
4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133279785) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133279785 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methylamino]-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2c(C)n[nH]c2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N5O4S/c1-8-11(9(2)17-16-8)7-15-12-5-4-10(23(21,22)14-3)6-13(12)18(19)20/h4-6,14-15H,7H2,1-3H3,(H,16,17) |
| InChIKey | LNDPUWJPXSMASB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 130.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|