C16H20N4O5S — CID 133367443
3,4-diethyl-5-[(4-methylsulfonyl-2-nitroanilino)methyl]-1H-pyridazin-6-one (PubChem CID 133367443) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3,4-diethyl-5-[(4-methylsulfonyl-2-nitroanilino)methyl]-1H-pyridazin-6-one.
| Compound Name | 3,4-diethyl-5-[(4-methylsulfonyl-2-nitroanilino)methyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 133367443 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3,4-diethyl-5-[(4-methylsulfonyl-2-nitroanilino)methyl]-1H-pyridazin-6-one |
| SMILES | CCc1n[nH]c(=O)c(CNc2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c1CC |
| InChI | InChI=1S/C16H20N4O5S/c1-4-11-12(16(21)19-18-13(11)5-2)9-17-14-7-6-10(26(3,24)25)8-15(14)20(22)23/h6-8,17H,4-5,9H2,1-3H3,(H,19,21) |
| InChIKey | HISCVDSHGMNNMJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|