C11H16N2O4S2 — CID 115756041
N-(2-methylsulfanylpropyl)-4-methylsulfonyl-2-nitroaniline (PubChem CID 115756041) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-(2-methylsulfanylpropyl)-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-(2-methylsulfanylpropyl)-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 115756041 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(2-methylsulfanylpropyl)-4-methylsulfonyl-2-nitroaniline |
| SMILES | CSC(C)CNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O4S2/c1-8(18-2)7-12-10-5-4-9(19(3,16)17)6-11(10)13(14)15/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | CGAFXZFIXKRDGP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|