C17H29N3O4S — CID 46530941
2-N,2-N-diethyl-4-methyl-1-N-(4-methylsulfonyl-2-nitrophenyl)pentane-1,2-diamine (PubChem CID 46530941) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-methyl-1-N-(4-methylsulfonyl-2-nitrophenyl)pentane-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-4-methyl-1-N-(4-methylsulfonyl-2-nitrophenyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 46530941 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-N,2-N-diethyl-4-methyl-1-N-(4-methylsulfonyl-2-nitrophenyl)pentane-1,2-diamine |
| SMILES | CCN(CC)C(CNc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])CC(C)C |
| InChI | InChI=1S/C17H29N3O4S/c1-6-19(7-2)14(10-13(3)4)12-18-16-9-8-15(25(5,23)24)11-17(16)20(21)22/h8-9,11,13-14,18H,6-7,10,12H2,1-5H3 |
| InChIKey | LADRSJFZCPHZJZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|