C19H33N5O4S — CID 25408898
(2R)-2-N,2-N,4-trimethyl-1-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pentane-1,2-diamine (PubChem CID 25408898) has the molecular formula C19H33N5O4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (2R)-2-N,2-N,4-trimethyl-1-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pentane-1,2-diamine.
| Compound Name | (2R)-2-N,2-N,4-trimethyl-1-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 25408898 |
| Molecular Formula | C19H33N5O4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | (2R)-2-N,2-N,4-trimethyl-1-N-[4-(4-methylpiperazin-1-yl)sulfonyl-2-nitrophenyl]pentane-1,2-diamine |
| SMILES | CC(C)C[C@H](CNc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-])N(C)C |
| InChI | InChI=1S/C19H33N5O4S/c1-15(2)12-16(21(3)4)14-20-18-7-6-17(13-19(18)24(25)26)29(27,28)23-10-8-22(5)9-11-23/h6-7,13,15-16,20H,8-12,14H2,1-5H3/t16-/m1/s1 |
| InChIKey | UOVJAJJKJVECLL-MRXNPFEDSA-N |
| XLogP | 1.92 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|