C13H20N4O4S — CID 9280563
N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 9280563) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 9280563 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N,N-dimethyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C13H20N4O4S/c1-14(2)12-5-4-11(10-13(12)17(18)19)22(20,21)16-8-6-15(3)7-9-16/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | OWWJXHRYQHYPNY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|