C18H26N6O4S — CID 100710775
N-[(2-ethylpyrazol-3-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline (PubChem CID 100710775) has the molecular formula C18H26N6O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 100710775 |
| Molecular Formula | C18H26N6O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-N-methyl-4-(4-methylpiperazin-1-yl)sulfonyl-2-nitroaniline |
| SMILES | CCn1nccc1CN(C)c1ccc(S(=O)(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N6O4S/c1-4-23-15(7-8-19-23)14-21(3)17-6-5-16(13-18(17)24(25)26)29(27,28)22-11-9-20(2)10-12-22/h5-8,13H,4,9-12,14H2,1-3H3 |
| InChIKey | DSNWJQYNIQFPQS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 104.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|