C19H22FN3O6S — CID 31920923
N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 31920923) has the molecular formula C19H22FN3O6S and a molecular weight of 439.47 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 31920923 |
| Molecular Formula | C19H22FN3O6S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | COc1ccc(CN(C)c2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])cc1F |
| InChI | InChI=1S/C19H22FN3O6S/c1-21(13-14-3-6-19(28-2)16(20)11-14)17-5-4-15(12-18(17)23(24)25)30(26,27)22-7-9-29-10-8-22/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | YSEQKXAOOQRWJS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|