C21H25FN2O5S — CID 34736303
N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 34736303) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 34736303 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCN(Cc1ccc(OC)c(F)c1)C(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-3-23(15-16-7-8-20(28-2)19(22)13-16)21(25)17-5-4-6-18(14-17)30(26,27)24-9-11-29-12-10-24/h4-8,13-14H,3,9-12,15H2,1-2H3 |
| InChIKey | MWVIANVBJXTIHS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |