C20H25FN2O4S — CID 25331324
N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-(propylsulfonylamino)benzamide (PubChem CID 25331324) has the molecular formula C20H25FN2O4S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-(propylsulfonylamino)benzamide.
| Compound Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 25331324 |
| Molecular Formula | C20H25FN2O4S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-ethyl-N-[(3-fluoro-4-methoxyphenyl)methyl]-3-(propylsulfonylamino)benzamide |
| SMILES | CCCS(=O)(=O)Nc1cccc(C(=O)N(CC)Cc2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C20H25FN2O4S/c1-4-11-28(25,26)22-17-8-6-7-16(13-17)20(24)23(5-2)14-15-9-10-19(27-3)18(21)12-15/h6-10,12-13,22H,4-5,11,14H2,1-3H3 |
| InChIKey | XVLMZWHHDAALOK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |