C16H17N3O6 — CID 9182298
N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-2,4-dinitroaniline (PubChem CID 9182298) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-2,4-dinitroaniline.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-2,4-dinitroaniline |
|---|---|
| PubChem CID | 9182298 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-2,4-dinitroaniline |
| SMILES | COc1ccc(CN(C)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H17N3O6/c1-17(10-11-4-7-15(24-2)16(8-11)25-3)13-6-5-12(18(20)21)9-14(13)19(22)23/h4-9H,10H2,1-3H3 |
| InChIKey | LIPHOKDEDRIIID-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|