C18H18N4O5 — CID 38006514
N-cyclopropyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide (PubChem CID 38006514) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-cyclopropyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide |
|---|---|
| PubChem CID | 38006514 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-cyclopropyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide |
| SMILES | CN(Cc1ccc(C(=O)NC2CC2)cc1)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O5/c1-20(16-9-8-15(21(24)25)10-17(16)22(26)27)11-12-2-4-13(5-3-12)18(23)19-14-6-7-14/h2-5,8-10,14H,6-7,11H2,1H3,(H,19,23) |
| InChIKey | FAONJZMJZAKDGG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|