C16H16N4O5 — CID 26448032
N-methyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide (PubChem CID 26448032) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is N-methyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide.
| Compound Name | N-methyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide |
|---|---|
| PubChem CID | 26448032 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-methyl-4-[(N-methyl-2,4-dinitroanilino)methyl]benzamide |
| SMILES | CNC(=O)c1ccc(CN(C)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N4O5/c1-17-16(21)12-5-3-11(4-6-12)10-18(2)14-8-7-13(19(22)23)9-15(14)20(24)25/h3-9H,10H2,1-2H3,(H,17,21) |
| InChIKey | ZUTRVUBTLJKTDS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|