C9H8N3O6- — CID 7099160
2-(N-methyl-2,4-dinitroanilino)acetate (PubChem CID 7099160) has the molecular formula C9H8N3O6- and a molecular weight of 254.18 g/mol. Its IUPAC name is 2-(N-methyl-2,4-dinitroanilino)acetate.
| Compound Name | 2-(N-methyl-2,4-dinitroanilino)acetate |
|---|---|
| PubChem CID | 7099160 |
| Molecular Formula | C9H8N3O6- |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(N-methyl-2,4-dinitroanilino)acetate |
| SMILES | CN(CC(=O)[O-])c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O6/c1-10(5-9(13)14)7-3-2-6(11(15)16)4-8(7)12(17)18/h2-4H,5H2,1H3,(H,13,14)/p-1 |
| InChIKey | SDUKWLYCRWBFJD-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|