C13H17N3O5 — CID 102636088
2-(N-methyl-2,4-dinitroanilino)cyclohexan-1-ol (PubChem CID 102636088) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-(N-methyl-2,4-dinitroanilino)cyclohexan-1-ol.
| Compound Name | 2-(N-methyl-2,4-dinitroanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102636088 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-(N-methyl-2,4-dinitroanilino)cyclohexan-1-ol |
| SMILES | CN(c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C1CCCCC1O |
| InChI | InChI=1S/C13H17N3O5/c1-14(11-4-2-3-5-13(11)17)10-7-6-9(15(18)19)8-12(10)16(20)21/h6-8,11,13,17H,2-5H2,1H3 |
| InChIKey | JDFREZICEQMOTF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|