C8H7N3O6 — CID 163792600
(2,4-dinitrophenyl)-methylcarbamic acid (PubChem CID 163792600) has the molecular formula C8H7N3O6 and a molecular weight of 241.16 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-methylcarbamic acid.
| Compound Name | (2,4-dinitrophenyl)-methylcarbamic acid |
|---|---|
| PubChem CID | 163792600 |
| Molecular Formula | C8H7N3O6 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | (2,4-dinitrophenyl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7N3O6/c1-9(8(12)13)6-3-2-5(10(14)15)4-7(6)11(16)17/h2-4H,1H3,(H,12,13) |
| InChIKey | MYCHEQABEUSIJS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|